| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:29:12 UTC |
|---|
| Update Date | 2025-03-21 18:41:03 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00132272 |
|---|
| Frequency | 19.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H20N2O3 |
|---|
| Molecular Mass | 264.1474 |
|---|
| SMILES | COc1ccc(NC=O)c(C(C)CCNC(C)=O)c1 |
|---|
| InChI Key | IXXBSUCECNKXAI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | anilides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acetamidesalkyl aryl ethersanisolescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesmethoxybenzenesn-arylamidesorganic oxidesorganopnictogen compoundsphenoxy compoundssecondary carboxylic acid amides |
|---|
| Substituents | phenol ethercarbonyl groupethern-arylamidealkyl aryl ethercarboxamide groupcarboxylic acid derivativemethoxybenzenearomatic homomonocyclic compoundanilidesecondary carboxylic acid amideorganic oxideorganic oxygen compoundanisoleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundphenoxy compoundacetamideorganooxygen compound |
|---|
