| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-21 00:29:13 UTC |
|---|
| Update Date | 2025-03-21 18:41:04 UTC |
|---|
| HMDB ID | HMDB0030319 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00132308 |
|---|
| Name | Mukeic acid |
|---|
| Frequency | 19.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H9NO3 |
|---|
| Molecular Mass | 227.0582 |
|---|
| SMILES | O=C(O)c1cc(O)c2[nH]c3ccccc3c2c1 |
|---|
| InChI Key | HKOVAOLUBZZCGO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | carbazoles |
|---|
| Direct Parent | carbazoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsazacyclic compoundsbenzenoidscarboxylic acidsheteroaromatic compoundshydrocarbon derivativeshydroxybenzoic acid derivativesindolecarboxylic acidsindolesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundspyrroles |
|---|
| Substituents | carboxylic acidindole1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativeorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundindolecarboxylic acid derivativeazacycleheteroaromatic compound1-hydroxy-4-unsubstituted benzenoidcarbazolehydroxybenzoic acidmonocarboxylic acid or derivativesorganic oxygen compoundindolecarboxylic acidpyrrolehydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|
