| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:29:26 UTC |
|---|
| Update Date | 2025-03-21 18:41:10 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00132818 |
|---|
| Frequency | 19.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H18FN3O2 |
|---|
| Molecular Mass | 279.1383 |
|---|
| SMILES | CC(=O)Nc1ccc(N2CCN(C(C)=O)CC2)c(F)c1 |
|---|
| InChI Key | QUYUWQKEUXRVHT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazinanes |
|---|
| Subclass | piperazines |
|---|
| Direct Parent | phenylpiperazines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesamino acids and derivativesaniline and substituted anilinesaryl fluoridesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdialkylarylaminesfluorobenzeneshydrocarbon derivativesm-haloacetanilidesn-acetylarylaminesn-arylpiperazinesorganic oxidesorganofluoridesorganopnictogen compoundssecondary carboxylic acid amidestertiary carboxylic acid amides |
|---|
| Substituents | aryl fluoridemonocyclic benzene moietycarbonyl groupn-acetylarylaminearomatic heteromonocyclic compoundamino acid or derivativesn-arylamidecarboxylic acid derivativeorganohalogen compoundhaloacetanilidefluorobenzeneorganic oxidetertiary aliphatic/aromatic aminetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compounddialkylarylaminetertiary amineacetamideazacycleacetanilideorganofluorideaniline or substituted anilinescarboxamide grouparyl halidephenylpiperazineanilidesecondary carboxylic acid amideorganic oxygen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundhalobenzeneaminen-arylpiperazinem-haloacetanilideorganooxygen compound |
|---|
