| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:29:29 UTC |
|---|
| Update Date | 2025-03-21 18:41:11 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00132910 |
|---|
| Frequency | 19.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H28O5 |
|---|
| Molecular Mass | 324.1937 |
|---|
| SMILES | COCCc1ccc(OC2OC(C(O)O)C(C)C(C)C2C)cc1 |
|---|
| InChI Key | KQSQFVCFXHFDBD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | tyrosols and derivatives |
|---|
| Direct Parent | tyrosols and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalscarbonyl hydratesdialkyl ethershydrocarbon derivativesoxacyclic compoundsoxanesphenol ethersphenoxy compounds |
|---|
| Substituents | phenol ethermonocyclic benzene moietyethercarbonyl hydratearomatic heteromonocyclic compounddialkyl etheroxacycleorganic oxygen compoundacetalhydrocarbon derivativetyrosol derivativephenoxy compoundoxaneorganoheterocyclic compoundorganooxygen compound |
|---|
