| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-21 00:29:34 UTC |
|---|
| Update Date | 2025-03-21 18:41:14 UTC |
|---|
| HMDB ID | HMDB0251451 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00133113 |
|---|
| Name | Diphenyl sulfate |
|---|
| Frequency | 18.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H10O4S |
|---|
| Molecular Mass | 250.03 |
|---|
| SMILES | O=S(=O)(Oc1ccccc1)Oc1ccccc1 |
|---|
| InChI Key | ZUGPRXZCSHTXTE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | arylsulfates |
|---|
| Direct Parent | arylsulfates |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | hydrocarbon derivativesorganic oxidesorganooxygen compoundsphenoxy compoundssulfuric acid diesters |
|---|
| Substituents | monocyclic benzene moietyaromatic homomonocyclic compoundorganic oxidesulfuric acid diesterorganic oxygen compoundhydrocarbon derivativearylsulfatebenzenoidphenoxy compoundsulfuric acid esterorganooxygen compound |
|---|
