| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:29:42 UTC |
|---|
| Update Date | 2025-03-21 18:41:17 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00133392 |
|---|
| Frequency | 31.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H8N4OS |
|---|
| Molecular Mass | 196.0419 |
|---|
| SMILES | CSc1nc(=O)c2c(ncn2C)[nH]1 |
|---|
| InChI Key | YDEUSBVLMFDPES-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | hypoxanthines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkylarylthioethersazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesn-substituted imidazolesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundspurines and purine derivativespyrimidonessulfenyl compoundsvinylogous amides |
|---|
| Substituents | pyrimidonealkylarylthioetherorganosulfur compoundaryl thioetherpyrimidineorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundazolen-substituted imidazolevinylogous amidesulfenyl compoundazacycleheteroaromatic compoundorganic oxygen compoundthioetherhypoxanthinehydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
