| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-21 00:29:44 UTC |
|---|
| Update Date | 2025-03-21 18:41:17 UTC |
|---|
| HMDB ID | HMDB0240664 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00133487 |
|---|
| Name | Benzoylcarnitine |
|---|
| Frequency | 18.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H20NO4+ |
|---|
| Molecular Mass | 266.1387 |
|---|
| SMILES | C[N+](C)(C)CC(CC(=O)O)OC(=O)c1ccccc1 |
|---|
| InChI Key | AWUHAZDZHNWQAG-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzoic acid esters |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aminesbenzoyl derivativescarbonyl compoundscarboxylic acid esterscarboxylic acidsdicarboxylic acids and derivativeshydrocarbon derivativesorganic cationsorganic oxidesorganic saltsorganopnictogen compoundstetraalkylammonium salts |
|---|
| Substituents | carbonyl groupcarboxylic acidtetraalkylammonium saltquaternary ammonium saltbenzoylbenzoate estercarboxylic acid derivativearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundcarboxylic acid esterorganonitrogen compounddicarboxylic acid or derivativesorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganic cationorganic saltamineorganooxygen compound |
|---|
