| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:29:47 UTC |
|---|
| Update Date | 2025-03-21 18:41:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00133607 |
|---|
| Frequency | 18.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H18O25P6 |
|---|
| Molecular Mass | 687.8563 |
|---|
| SMILES | O=C(O)P(=O)(O)OC1C(OP(=O)(O)O)C(OP(=O)(O)O)C(OP(=O)(O)O)C(OP(=O)(O)O)C1OP(=O)(O)O |
|---|
| InChI Key | IBOYOJPFQYEMDA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | inositol phosphates |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | hydrocarbon derivativesmonoalkyl phosphatesorganic carbonic acids and derivativesorganic oxidesorganic phosphonic acids and derivativesorganooxygen compoundsorganophosphorus compoundsorganopnictogen compounds |
|---|
| Substituents | carbonic acid derivativeinositol phosphateorganic oxidephosphoric acid estermonoalkyl phosphatealiphatic homomonocyclic compoundorganopnictogen compoundorganophosphorus compoundhydrocarbon derivativeorganic phosphoric acid derivativeorganophosphonic acid derivativealkyl phosphate |
|---|
