| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:29:53 UTC |
|---|
| Update Date | 2025-03-21 18:41:21 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00133821 |
|---|
| Frequency | 18.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H5Cl5 |
|---|
| Molecular Mass | 275.8834 |
|---|
| SMILES | ClC(Cl)(Cl)C(Cl)(Cl)c1ccccc1 |
|---|
| InChI Key | AXVLZOYLQOEKAO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzene and substituted derivatives |
|---|
| Direct Parent | benzene and substituted derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl chlorideshydrocarbon derivativesorganochlorides |
|---|
| Substituents | aromatic homomonocyclic compoundmonocyclic benzene moietyalkyl chlorideorganochloridealkyl halidehydrocarbon derivativeorganohalogen compound |
|---|
