| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-21 00:30:05 UTC |
|---|
| Update Date | 2025-03-21 18:41:26 UTC |
|---|
| HMDB ID | HMDB0060371 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00134256 |
|---|
| Name | 3-Fumarylpyruvate |
|---|
| Frequency | 18.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H6O6 |
|---|
| Molecular Mass | 186.0164 |
|---|
| SMILES | O=C(O)C=CC(=O)CC(=O)C(=O)O |
|---|
| InChI Key | AZCFLHZUFANAOR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | keto acids and derivatives |
|---|
| Subclass | medium-chain keto acids and derivatives |
|---|
| Direct Parent | medium-chain keto acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | 3-acylpyruvic acidsacryloyl compoundsalpha-hydroxy ketonesalpha-keto acids and derivativescarboxylic acidsdicarboxylic acids and derivativesenonesfatty acylshydrocarbon derivativesorganic oxidesunsaturated fatty acids |
|---|
| Substituents | fatty acylaliphatic acyclic compoundcarbonyl group3-acylpyruvic acidcarboxylic acidalpha,beta-unsaturated ketonealpha-hydroxy ketonecarboxylic acid derivativegamma-keto acidketoneunsaturated fatty acidorganic oxideorganic oxygen compoundalpha-keto aciddicarboxylic acid or derivativeshydrocarbon derivativeacryloyl-grouporganooxygen compoundenonemedium-chain keto acid |
|---|
