| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:30:09 UTC |
|---|
| Update Date | 2025-03-21 18:41:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00134403 |
|---|
| Frequency | 18.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H25NO2 |
|---|
| Molecular Mass | 287.1885 |
|---|
| SMILES | COc1ccc2c(c1O)C13CCCCC1C(C2)N(C)CC3 |
|---|
| InChI Key | FOMOAEUYWZDTNS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | alkaloids and derivatives |
|---|
| Class | morphinans |
|---|
| Subclass | morphinans |
|---|
| Direct Parent | morphinans |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-4-unsubstituted benzenoidsalkyl aryl ethersanisolesazacyclic compoundsbenzazocineshydrocarbon derivativesorganopnictogen compoundsphenanthrenes and derivativespiperidinestetralinstrialkylamines |
|---|
| Substituents | tetralinphenol etheretheralkyl aryl etheraromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundpiperidinetertiary amineorganoheterocyclic compoundphenanthreneazacycletertiary aliphatic amine1-hydroxy-4-unsubstituted benzenoidorganic oxygen compoundanisolebenzazocinehydrocarbon derivativebenzenoidorganic nitrogen compoundmorphinanamineorganooxygen compound |
|---|
