| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-21 00:30:11 UTC |
|---|
| Update Date | 2025-03-21 18:41:28 UTC |
|---|
| HMDB ID | HMDB0039177 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00134460 |
|---|
| Name | 1-O-Galloylglycerol |
|---|
| Frequency | 18.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H12O7 |
|---|
| Molecular Mass | 244.0583 |
|---|
| SMILES | O=C(OCC(O)CO)c1cc(O)c(O)c(O)c1 |
|---|
| InChI Key | PDEQYQCQYAQJPN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | m-hydroxybenzoic acid esters |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1,2-diols1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzoyl derivativescarboxylic acid estersglycerolipidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesprimary alcoholspyrogallols and derivativessecondary alcoholsp-hydroxybenzoic acid alkyl esters |
|---|
| Substituents | p-hydroxybenzoic acid esterbenzoyl1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativeorganic oxideprimary alcoholm-hydroxybenzoic acid ester1,2-diolalcoholpyrogallol derivativebenzenetriol1-hydroxy-4-unsubstituted benzenoidp-hydroxybenzoic acid alkyl esteraromatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundglycerolipidcarboxylic acid estersecondary alcoholphenolhydrocarbon derivativeorganooxygen compound |
|---|
