| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:30:15 UTC |
|---|
| Update Date | 2025-03-21 18:41:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00134615 |
|---|
| Frequency | 18.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H4O7 |
|---|
| Molecular Mass | 199.9957 |
|---|
| SMILES | O=C(O)c1cc(C(=O)O)c(C(=O)O)o1 |
|---|
| InChI Key | PTCAWUKVIOPGCI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | tricarboxylic acids and derivatives |
|---|
| Direct Parent | tricarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | carboxylic acidsfuran-3-carboxylic acidsfuroic acidsheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganooxygen compoundsoxacyclic compounds |
|---|
| Substituents | furanfuroic acid or derivativesfuran-3-carboxylic acidcarboxylic acidaromatic heteromonocyclic compoundheteroaromatic compoundtricarboxylic acid or derivativesfuroic acidoxacycleorganic oxideorganic oxygen compoundhydrocarbon derivativefuran-3-carboxylic acid or derivativesorganoheterocyclic compoundorganooxygen compound |
|---|
