| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:30:15 UTC |
|---|
| Update Date | 2025-03-21 18:41:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00134618 |
|---|
| Frequency | 18.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H11N5O4 |
|---|
| Molecular Mass | 253.0811 |
|---|
| SMILES | Nc1nc(=O)c2c([nH]1)NCC(C(O)C(O)C=O)=N2 |
|---|
| InChI Key | PNORNULYYIBPAS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsalpha-hydroxyaldehydesazacyclic compoundsbeta-hydroxy aldehydesheteroaromatic compoundshydrocarbon derivativesketiminesmonosaccharidesorganic oxidesorganopnictogen compoundsprimary aminespropargyl-type 1,3-dipolar organic compoundspyrimidonessecondary alcoholssecondary alkylarylaminesvinylogous amides |
|---|
| Substituents | ketiminebeta-hydroxy aldehydecarbonyl groupiminemonosaccharidepyrimidonepyrimidinepropargyl-type 1,3-dipolar organic compoundsaccharideorganic oxidealpha-hydroxyaldehydearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compound1,2-diolalcoholvinylogous amidepterinazacycleheteroaromatic compoundaldehydeorganic 1,3-dipolar compoundsecondary aminesecondary aliphatic/aromatic amineorganic oxygen compoundsecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
