Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 00:30:18 UTC |
---|
Update Date | 2025-03-21 18:41:32 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00134735 |
---|
Frequency | 18.7 |
---|
Structure | |
---|
Chemical Formula | C11H14N2O4 |
---|
Molecular Mass | 238.0954 |
---|
SMILES | NC(C(=O)NC(CO)C(=O)O)c1ccccc1 |
---|
InChI Key | HOLHLWKPQMYCBY-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | carboxylic acids and derivatives |
---|
Subclass | amino acids, peptides, and analogues |
---|
Direct Parent | dipeptides |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | alpha amino acid amidesalpha amino acidsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonoalkylaminesmonocarboxylic acids and derivativesn-acyl-alpha amino acidsorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenylacetamidesprimary alcoholssecondary carboxylic acid amidesserine and derivatives |
---|
Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acidalpha-amino acid or derivativesbeta-hydroxy acidorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundprimary alcoholphenylacetamiden-acyl-alpha amino acid or derivativesalcoholalpha-amino acid amiden-acyl-alpha-amino acidhydroxy acidcarboxamide grouparomatic homomonocyclic compoundalpha-dipeptidesecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundserine or derivativesorganooxygen compound |
---|