Record Information |
---|
HMDB Status | expected |
---|
Creation Date | 2024-02-21 00:30:31 UTC |
---|
Update Date | 2025-03-21 18:41:37 UTC |
---|
HMDB ID | HMDB0032957 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00135211 |
---|
Name | 2-O-Feruloyltartronic acid |
---|
Frequency | 18.6 |
---|
Structure | |
---|
Chemical Formula | C13H12O8 |
---|
Molecular Mass | 296.0532 |
---|
SMILES | COc1cc(C=CC(=O)OC(C(=O)O)C(=O)O)ccc1O |
---|
InChI Key | ZWXOJLRXYPVVQY-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | phenylpropanoids and polyketides |
---|
Class | cinnamic acids and derivatives |
---|
Subclass | hydroxycinnamic acids and derivatives |
---|
Direct Parent | hydroxycinnamic acids |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | 1,3-dicarbonyl compounds1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersanisolescarboxylic acidsenoate estersfatty acid estershydrocarbon derivativesmethoxybenzenesmethoxyphenolsorganic oxidesphenoxy compoundstricarboxylic acids and derivatives |
---|
Substituents | fatty acylphenol ethermonocyclic benzene moietycarbonyl groupethercarboxylic acid1-hydroxy-2-unsubstituted benzenoidmethoxyphenoltricarboxylic acid or derivativesalkyl aryl ethercarboxylic acid derivativealpha,beta-unsaturated carboxylic esterorganic oxideenoate estermethoxybenzenehydroxycinnamic acidaromatic homomonocyclic compoundfatty acid esterorganic oxygen compoundanisolecarboxylic acid esterphenolhydrocarbon derivativebenzenoid1,3-dicarbonyl compoundphenoxy compoundorganooxygen compound |
---|