| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:30:34 UTC |
|---|
| Update Date | 2025-03-21 18:41:38 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00135328 |
|---|
| Frequency | 18.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H12N4O4 |
|---|
| Molecular Mass | 228.0859 |
|---|
| SMILES | CC(O)C(=O)Nc1c(N)n(C)c(=O)[nH]c1=O |
|---|
| InChI Key | HXPNFRPDIQAUTI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic nitrogen compounds |
|---|
| Class | organonitrogen compounds |
|---|
| Subclass | n-arylamides |
|---|
| Direct Parent | n-arylamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativeslactamsorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundsprimary aminespyrimidonessecondary alcoholssecondary carboxylic acid amidesvinylogous amides |
|---|
| Substituents | carbonyl grouplactamaromatic heteromonocyclic compoundamino acid or derivativespyrimidonen-arylamidecarboxylic acid derivativepyrimidineorganic oxideorganopnictogen compoundorganoheterocyclic compoundalcoholvinylogous amidecarbonic acid derivativeazacycleheteroaromatic compoundcarboxamide groupsecondary carboxylic acid amideorganic oxygen compoundsecondary alcoholhydrocarbon derivativeprimary amineamineorganooxygen compound |
|---|
