| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:30:36 UTC |
|---|
| Update Date | 2025-03-21 18:41:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00135396 |
|---|
| Frequency | 18.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H11NO4 |
|---|
| Molecular Mass | 245.0688 |
|---|
| SMILES | O=C(O)CNC(=O)c1ccc2ccccc2c1O |
|---|
| InChI Key | PVSVLYDIFTVFQD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | acyl glycines |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-4-unsubstituted benzenoidsalpha amino acidscarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesnaphthalenecarboxamidesnaphthalenecarboxylic acidsnaphthols and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssalicylic acid and derivativessecondary carboxylic acid amidesvinylogous acids |
|---|
| Substituents | carbonyl groupcarboxylic acidorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundaromatic homopolycyclic compound1-hydroxy-4-unsubstituted benzenoidcarboxamide groupn-acylglycine2-naphthalenecarboxamidesecondary carboxylic acid amidevinylogous acidmonocarboxylic acid or derivativesnaphthaleneorganic oxygen compoundsalicylic acid or derivatives2-naphthalenecarboxylic acid or derivativeshydrocarbon derivative1-naphtholbenzenoidorganic nitrogen compound2-naphthalenecarboxylic acidorganooxygen compound |
|---|
