| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:30:41 UTC |
|---|
| Update Date | 2025-03-21 18:41:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00135588 |
|---|
| Frequency | 18.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H14N3O8P |
|---|
| Molecular Mass | 335.0519 |
|---|
| SMILES | Nc1ccn(C2OC(C(O)CO)C3OP(=O)(O)OC32)c(=O)n1 |
|---|
| InChI Key | SWUDSDPSFYQZAA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | pyrimidine nucleotides |
|---|
| Subclass | cyclic pyrimidine nucleotides |
|---|
| Direct Parent | 2',3'-cyclic pyrimidine nucleotides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsazacyclic compoundsdioxaphospholanesheteroaromatic compoundshydrocarbon derivativesimidolactamsorganic carbonic acids and derivativesorganic oxidesorganic phosphoric acids and derivativesorganopnictogen compoundsoxacyclic compoundsprimary alcoholsprimary aminespyrimidonesribonucleoside 3'-phosphatessecondary alcoholstetrahydrofurans |
|---|
| Substituents | pyrimidonepyrimidineorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundprimary alcoholimidolactamorganoheterocyclic compound1,2-diolribonucleoside 3'-phosphatealcoholcarbonic acid derivativeazacycletetrahydrofuranheteroaromatic compound1,3_dioxaphospholane2',3'-cyclic pyrimidine ribonucleotideoxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundorganic phosphoric acid derivativeamineorganooxygen compound |
|---|
