| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:30:42 UTC |
|---|
| Update Date | 2025-03-21 18:41:42 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00135662 |
|---|
| Frequency | 18.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H21NO2 |
|---|
| Molecular Mass | 283.1572 |
|---|
| SMILES | CC(=O)N(C)CCOC(c1ccccc1)c1ccccc1 |
|---|
| InChI Key | RRLHRDNTUZHNAO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acetamidesbenzyletherscarbonyl compoundscarboxylic acids and derivativesdialkyl ethershydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundstertiary carboxylic acid amides |
|---|
| Substituents | diphenylmethanecarbonyl groupetherbenzylethercarboxamide groupcarboxylic acid derivativedialkyl etheraromatic homomonocyclic compoundorganic oxideorganic oxygen compoundtertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundacetamideorganooxygen compound |
|---|
