| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:30:46 UTC |
|---|
| Update Date | 2025-03-21 18:41:44 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00135800 |
|---|
| Frequency | 18.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H14O7 |
|---|
| Molecular Mass | 258.074 |
|---|
| SMILES | Oc1cc(C2OCC(O)C(O)C2O)cc(O)c1O |
|---|
| InChI Key | KTYACMWWBPXJCZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | benzenetriols and derivatives |
|---|
| Direct Parent | pyrogallols and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzene and substituted derivativesdialkyl ethershydrocarbon derivativesmonosaccharidesoxacyclic compoundsoxanessecondary alcohols |
|---|
| Substituents | alcoholmonocyclic benzene moietyetherpyrogallol derivativearomatic heteromonocyclic compound1-hydroxy-2-unsubstituted benzenoidmonosaccharide1-hydroxy-4-unsubstituted benzenoiddialkyl etheroxacyclesaccharideorganic oxygen compoundsecondary alcoholhydrocarbon derivativeoxaneorganoheterocyclic compoundorganooxygen compound |
|---|
