| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:30:46 UTC |
|---|
| Update Date | 2025-03-21 18:41:44 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00135811 |
|---|
| Frequency | 44.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H13N4O8P |
|---|
| Molecular Mass | 360.0471 |
|---|
| SMILES | O=c1[nH]cnc2c1ncn2C1OC2COP(=O)(O)OC2C(O)C1O |
|---|
| InChI Key | XMZXLJFQHGGHOS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | hexose phosphates |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativeshypoxanthinesimidazoleslactamsmonosaccharidesn-substituted imidazolesorganic oxidesorganic phosphoric acids and derivativesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanespurines and purine derivativespyrimidonessecondary alcoholsvinylogous amides |
|---|
| Substituents | lactampyrimidoneimidazopyrimidinepyrimidineorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundoxaneorganoheterocyclic compoundazole1,2-dioln-substituted imidazolealcoholvinylogous amideazacycleheteroaromatic compoundoxacyclesecondary alcoholhexose phosphatehypoxanthinehydrocarbon derivativepurineorganic nitrogen compoundorganic phosphoric acid derivative |
|---|
