| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-21 00:30:51 UTC |
|---|
| Update Date | 2025-03-21 18:41:46 UTC |
|---|
| HMDB ID | HMDB0259498 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00136001 |
|---|
| Name | Allo-hydroxycitric acid lactone |
|---|
| Frequency | 18.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H6O7 |
|---|
| Molecular Mass | 190.0114 |
|---|
| SMILES | O=C1CC(O)(C(=O)O)C(C(=O)O)O1 |
|---|
| InChI Key | PFHZIWAVXDSFTB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | tricarboxylic acids and derivatives |
|---|
| Direct Parent | tricarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativescarbonyl compoundscarboxylic acid esterscarboxylic acidsgamma butyrolactoneshydrocarbon derivativesmonosaccharidesorganic oxidesoxacyclic compoundstertiary alcoholstetrahydrofurans |
|---|
| Substituents | alcoholcarbonyl groupcarboxylic acidtetrahydrofuranalpha-hydroxy acidmonosaccharidetricarboxylic acid or derivativeshydroxy acidgamma butyrolactonelactoneoxacycletertiary alcoholsaccharideorganic oxideorganic oxygen compoundcarboxylic acid esteraliphatic heteromonocyclic compoundhydrocarbon derivativeorganoheterocyclic compoundorganooxygen compound |
|---|
