Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 00:30:55 UTC |
---|
Update Date | 2025-03-21 18:41:48 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00136159 |
---|
Frequency | 18.4 |
---|
Structure | |
---|
Chemical Formula | C15H17NO9 |
---|
Molecular Mass | 355.0903 |
---|
SMILES | COC1C(C(=O)O)OC(OC2Oc3ccccc3NC2=O)C(O)C1O |
---|
InChI Key | JYSQSWDGLJGJLO-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic oxygen compounds |
---|
Class | organooxygen compounds |
---|
Subclass | carbohydrates and carbohydrate conjugates |
---|
Direct Parent | o-glucuronides |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | 1,2-diolsacetalsazacyclic compoundsbenzenoidsbenzomorpholinesbenzoxazinonescarbonyl compoundscarboxylic acidsdialkyl ethersglucuronic acid derivativeshydrocarbon derivativeslactamsmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanespyran carboxylic acidssecondary alcoholssecondary carboxylic acid amides |
---|
Substituents | carbonyl groupetherlactamcarboxylic acido-glucuronidemonosaccharidecarboxylic acid derivativepyran carboxylic aciddialkyl etherbenzomorpholine1-o-glucuronideorganic oxideacetalaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundoxaneorganoheterocyclic compound1,2-diolalcoholpyran carboxylic acid or derivativesazacyclebenzoxazinecarboxamide groupoxazinaneoxacyclesecondary carboxylic acid amidemorpholinemonocarboxylic acid or derivativesbenzoxazinonepyransecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compound |
---|