| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:30:57 UTC |
|---|
| Update Date | 2025-03-21 18:41:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00136218 |
|---|
| Frequency | 18.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H8O7 |
|---|
| Molecular Mass | 216.027 |
|---|
| SMILES | O=C(O)C=C(CC(=O)CC(=O)O)C(=O)O |
|---|
| InChI Key | UYITXPMYIIDKSA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | tricarboxylic acids and derivatives |
|---|
| Direct Parent | tricarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | beta-hydroxy ketonesbeta-keto acids and derivativescarboxylic acidsgamma-keto acids and derivativeshydrocarbon derivativesorganic oxides |
|---|
| Substituents | beta-hydroxy ketonealiphatic acyclic compoundcarbonyl groupcarboxylic acidtricarboxylic acid or derivativesbeta-keto acidgamma-keto acidketoneorganic oxideorganic oxygen compoundketo acidhydrocarbon derivativeorganooxygen compound |
|---|
