| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:30:58 UTC |
|---|
| Update Date | 2025-03-21 18:41:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00136281 |
|---|
| Frequency | 18.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H11N4O6P |
|---|
| Molecular Mass | 314.0416 |
|---|
| SMILES | O=P1(O)OC2C(CO)OC(n3cnc4ncncc43)C2O1 |
|---|
| InChI Key | ZJSAQVZMAOBNEQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | purines and purine derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsdioxaphospholanesheteroaromatic compoundshydrocarbon derivativesimidazolesn-substituted imidazolesorganic oxidesorganic phosphoric acids and derivativesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholspyrimidines and pyrimidine derivativestetrahydrofurans |
|---|
| Substituents | alcoholazacycletetrahydrofuranheteroaromatic compound1,3_dioxaphospholanepyrimidineoxacycleorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativepurineorganic nitrogen compoundprimary alcoholorganic phosphoric acid derivativeorganooxygen compoundazolen-substituted imidazole |
|---|
