| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:30:58 UTC |
|---|
| Update Date | 2025-03-21 18:41:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00136287 |
|---|
| Frequency | 18.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H5Cl2NO4S |
|---|
| Molecular Mass | 268.9316 |
|---|
| SMILES | NS(=O)(=O)c1cc(Cl)c(C(=O)O)cc1Cl |
|---|
| InChI Key | ABRIPHOKMQIWDS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | dichlorobenzoic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compounds2-halobenzoic acids3-halobenzoic acidsaminosulfonyl compoundsaryl chloridesbenzenesulfonamidesbenzenesulfonyl compoundsbenzoyl derivativesdichlorobenzeneshalobenzoic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic nitrogen compoundsorganic oxidesorganochloridesorganooxygen compoundsorganosulfonamidesvinylogous halides |
|---|
| Substituents | organosulfonic acid or derivatives2-halobenzoic acidcarboxylic acid3-halobenzoic acid or derivativesorganochloridebenzoylorganosulfur compoundcarboxylic acid derivativeorganohalogen compoundorganosulfonic acid amideorganic oxide3-halobenzoic acid1-carboxy-2-haloaromatic compoundbenzenesulfonyl grouparyl chloridechlorobenzenehalobenzoic acidbenzenesulfonamide1,4-dichlorobenzeneaminosulfonyl compoundhalobenzoic acid or derivativesvinylogous halide2-halobenzoic acid or derivativesaryl halidearomatic homomonocyclic compoundmonocarboxylic acid or derivativessulfonylorganic oxygen compoundorganic sulfonic acid or derivatives2,5-dichlorobenzoic acidhydrocarbon derivativeorganic nitrogen compoundhalobenzeneorganooxygen compound |
|---|
