Record Information |
---|
HMDB Status | expected |
---|
Creation Date | 2024-02-21 00:31:03 UTC |
---|
Update Date | 2025-03-21 18:41:51 UTC |
---|
HMDB ID | HMDB0039935 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00136444 |
---|
Name | Dihydrogenistin |
---|
Frequency | 18.4 |
---|
Structure | |
---|
Chemical Formula | C21H22O10 |
---|
Molecular Mass | 434.1213 |
---|
SMILES | O=C1c2c(O)cc(OC3OC(CO)C(O)C(O)C3O)cc2OCC1c1ccc(O)cc1 |
---|
InChI Key | HZFUHKPAKUYSOB-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | phenylpropanoids and polyketides |
---|
Class | isoflavonoids |
---|
Subclass | isoflavonoid o-glycosides |
---|
Direct Parent | isoflavonoid o-glycosides |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacetalsalkyl aryl ethersaryl alkyl ketonesbenzene and substituted derivativeschromoneshydrocarbon derivativesisoflavanolsisoflavanonesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesphenol ethersprimary alcoholssecondary alcoholsvinylogous acids |
---|
Substituents | phenol ethermonocyclic benzene moietyetheraryl alkyl ketone1-benzopyranisoflavanol1-hydroxy-2-unsubstituted benzenoidisoflavonoid-7-o-glycosidemonosaccharidealkyl aryl etherisoflavanoneketonesaccharideorganic oxideacetalchromonearomatic heteropolycyclic compoundchromaneoxaneprimary alcoholorganoheterocyclic compoundalcoholisoflavanbenzopyranisoflavonoid o-glycoside1-hydroxy-4-unsubstituted benzenoidoxacyclevinylogous acidorganic oxygen compoundsecondary alcoholphenolhydrocarbon derivativebenzenoidorganooxygen compoundaryl ketone |
---|