| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:31:04 UTC |
|---|
| Update Date | 2025-03-21 18:41:51 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00136494 |
|---|
| Frequency | 18.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H11N5O4S |
|---|
| Molecular Mass | 333.0532 |
|---|
| SMILES | Nc1nc(=O)c2nc(S(=O)(=O)Cc3ccc(O)cc3)cnc2[nH]1 |
|---|
| InChI Key | QMCRAUDMCJNFIL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsazacyclic compoundsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganooxygen compoundsorganopnictogen compoundsprimary aminespyrazinespyrimidonessulfonesvinylogous amides |
|---|
| Substituents | monocyclic benzene moiety1-hydroxy-2-unsubstituted benzenoidpyrimidoneorganosulfur compoundpyrimidineorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundvinylogous amidepterinazacycleheteroaromatic compoundsulfonylorganic oxygen compoundpyrazinephenolhydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundamineorganooxygen compoundsulfone |
|---|
