| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:31:04 UTC |
|---|
| Update Date | 2025-03-21 18:41:52 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00136505 |
|---|
| Frequency | 18.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H23NO5 |
|---|
| Molecular Mass | 345.1576 |
|---|
| SMILES | CN1C2CC(OC(=O)C(CO)c3ccccc3)CC1C1OC(=O)CC12 |
|---|
| InChI Key | XNZMZJIHFCABLI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | furopyrroles |
|---|
| Subclass | furopyrroles |
|---|
| Direct Parent | furopyrroles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesazacyclic compoundsbenzene and substituted derivativesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acid estersdicarboxylic acids and derivativesfuransgamma butyrolactoneshydrocarbon derivativesn-alkylpyrrolidinesorganic oxidesorganopnictogen compoundsoxacyclic compoundspiperidinesprimary alcoholspyrrolestetrahydrofuranstrialkylamines |
|---|
| Substituents | furanmonocyclic benzene moietycarbonyl groupamino acid or derivativescarboxylic acid derivativefuropyrrolelactonebeta-hydroxy acidorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundpyrrolidineprimary alcoholpiperidinetertiary aminealcoholazacyclen-alkylpyrrolidinetetrahydrofurantertiary aliphatic aminehydroxy acidgamma butyrolactoneoxacycleorganic oxygen compoundcarboxylic acid esterpyrroledicarboxylic acid or derivativeshydrocarbon derivativebenzenoidorganic nitrogen compoundamineorganooxygen compound |
|---|
