| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:31:11 UTC |
|---|
| Update Date | 2025-03-21 18:41:55 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00136766 |
|---|
| Frequency | 18.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H10O9 |
|---|
| Molecular Mass | 250.0325 |
|---|
| SMILES | O=C(O)CC(O)(CC(C(=O)O)C(=O)O)C(=O)O |
|---|
| InChI Key | CHGCDYCWMPYJJR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | tetracarboxylic acids and derivatives |
|---|
| Direct Parent | tetracarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | 1,3-dicarbonyl compoundsalpha hydroxy acids and derivativescarboxylic acidshydrocarbon derivativesorganic oxidestertiary alcohols |
|---|
| Substituents | alcoholaliphatic acyclic compoundcarbonyl groupcarboxylic acidalpha-hydroxy acidtetracarboxylic acid or derivativeshydroxy acidtertiary alcoholorganic oxideorganic oxygen compoundhydrocarbon derivative1,3-dicarbonyl compoundorganooxygen compound |
|---|
