| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-21 00:31:15 UTC |
|---|
| Update Date | 2025-03-21 18:41:57 UTC |
|---|
| HMDB ID | HMDB0141530 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00136912 |
|---|
| Name | 6-hydroxy-2-phenyl-4H-chromen-4-one |
|---|
| Frequency | 18.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H10O3 |
|---|
| Molecular Mass | 238.063 |
|---|
| SMILES | O=c1cc(-c2ccccc2)oc2ccc(O)cc12 |
|---|
| InChI Key | GPZYYYGYCRFPBU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | hydroxyflavonoids |
|---|
| Direct Parent | 6-hydroxyflavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsbenzene and substituted derivativeschromonesflavonoidsheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganooxygen compoundsoxacyclic compoundspyranones and derivatives |
|---|
| Substituents | monocyclic benzene moietybenzopyran1-benzopyran6-hydroxyflavonoidheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidoxacycleorganic oxideorganic oxygen compoundchromonearomatic heteropolycyclic compoundpyranpyranonehydrocarbon derivativebenzenoidorganoheterocyclic compoundorganooxygen compound |
|---|
