| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:31:18 UTC |
|---|
| Update Date | 2025-03-21 18:41:58 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00137012 |
|---|
| Frequency | 18.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H10O8S |
|---|
| Molecular Mass | 266.0096 |
|---|
| SMILES | O=S(=O)(O)OCc1cc(O)c(O)c(O)c1CO |
|---|
| InChI Key | CGEVVEVYARLIRO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | benzenetriols and derivatives |
|---|
| Direct Parent | pyrogallols and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalkyl sulfatesaromatic alcoholsbenzyl alcoholshydrocarbon derivativesorganic oxidessulfuric acid monoesters |
|---|
| Substituents | aromatic alcoholalcoholmonocyclic benzene moietysulfuric acid monoesterorganic sulfuric acid or derivativespyrogallol derivative1-hydroxy-2-unsubstituted benzenoidbenzyl alcohol1-hydroxy-4-unsubstituted benzenoidaromatic homomonocyclic compoundorganic oxideorganic oxygen compoundalkyl sulfatesulfate-esterhydrocarbon derivativesulfuric acid esterorganooxygen compound |
|---|
