| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:31:18 UTC |
|---|
| Update Date | 2025-03-21 18:41:58 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00137040 |
|---|
| Frequency | 18.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H9Cl3O4 |
|---|
| Molecular Mass | 345.9566 |
|---|
| SMILES | O=C(O)Cc1cc(Cl)c(O)c(Oc2ccc(Cl)cc2Cl)c1 |
|---|
| InChI Key | ZGSNULTUZSHOGH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylethers |
|---|
| Direct Parent | diphenylethers |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aryl chloridescarbonyl compoundscarboxylic acidsdiarylethersdichlorobenzeneshalophenolshydrocarbon derivativesmonocarboxylic acids and derivativeso-chlorophenolsorganic oxidesorganochloridesphenol ethersphenoxy compounds |
|---|
| Substituents | diaryl etherphenol ethercarbonyl groupethercarboxylic acidorganochloridecarboxylic acid derivativeorganohalogen compound1,3-dichlorobenzeneorganic oxidearyl chloride2-chlorophenolchlorobenzenearyl halidearomatic homomonocyclic compound2-halophenolmonocarboxylic acid or derivativesorganic oxygen compoundphenolhydrocarbon derivativehalobenzenephenoxy compounddiphenyletherorganooxygen compound |
|---|
