| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:31:19 UTC |
|---|
| Update Date | 2025-03-21 18:41:58 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00137066 |
|---|
| Frequency | 18.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H16N3O9P |
|---|
| Molecular Mass | 353.0624 |
|---|
| SMILES | Nc1ccn(C2OC(CO)C(O)C(O)C2OP(=O)(O)O)c(=O)n1 |
|---|
| InChI Key | YBPONDNSSGQLPL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidones |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidolactamsmonoalkyl phosphatesmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholsprimary aminessecondary alcohols |
|---|
| Substituents | aromatic heteromonocyclic compoundmonosaccharidepyrimidonesaccharideorganic oxideorganonitrogen compoundorganopnictogen compoundoxaneprimary alcoholimidolactamalcoholcarbonic acid derivativeazacycleheteroaromatic compoundoxacycleorganic oxygen compoundphosphoric acid estermonoalkyl phosphatesecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundorganic phosphoric acid derivativeaminealkyl phosphateorganooxygen compound |
|---|
