| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:31:24 UTC |
|---|
| Update Date | 2025-03-21 18:42:00 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00137284 |
|---|
| Frequency | 18.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H7F3O2 |
|---|
| Molecular Mass | 216.0398 |
|---|
| SMILES | O=C(O)C=Cc1ccc(C(F)(F)F)cc1 |
|---|
| InChI Key | ANRMAUMHJREENI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | cinnamic acids and derivatives |
|---|
| Subclass | cinnamic acids and derivatives |
|---|
| Direct Parent | cinnamic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl fluoridescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganofluoridestrifluoromethylbenzenes |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acidalkyl fluorideorganofluoridecarboxylic acid derivativeorganohalogen compoundaromatic homomonocyclic compoundcinnamic acid or derivativesorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundalkyl halidehydrocarbon derivativebenzenoidtrifluoromethylbenzeneorganooxygen compound |
|---|
