| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:31:26 UTC |
|---|
| Update Date | 2025-03-21 18:42:02 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00137361 |
|---|
| Frequency | 18.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H13N5O2 |
|---|
| Molecular Mass | 235.1069 |
|---|
| SMILES | Nc1ncnc2c1ncn2C1CC(O)CC1O |
|---|
| InChI Key | UOANQKFGMFVIQR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | nucleoside and nucleotide analogues |
|---|
| Subclass | cyclopentyl nucleosides |
|---|
| Direct Parent | cyclopentyl nucleosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,3-substituted cyclopentyl purine nucleosidesazacyclic compoundscyclic alcohols and derivativescyclopentanolsheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsn-substituted imidazolesorganopnictogen compoundsprimary aminespurines and purine derivativespyrimidines and pyrimidine derivatives |
|---|
| Substituents | imidazopyrimidinepyrimidinearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundimidolactamorganoheterocyclic compoundazolen-substituted imidazolecyclopentyl nucleosidealcoholazacycleheteroaromatic compoundcyclic alcoholcyclopentanol1,3-substituted cyclopentyl purine nucleosideorganic oxygen compoundsecondary alcoholhydrocarbon derivativeprimary aminepurineorganic nitrogen compoundamineorganooxygen compound |
|---|
