| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:31:39 UTC |
|---|
| Update Date | 2025-03-21 18:42:08 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00137858 |
|---|
| Frequency | 31.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H14N6O3S3 |
|---|
| Molecular Mass | 338.029 |
|---|
| SMILES | NC(=O)Nc1nc(CSCCC(N)=NS(N)(=O)=O)cs1 |
|---|
| InChI Key | YXIGMDIUFQUWEZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | azoles |
|---|
| Subclass | thiazoles |
|---|
| Direct Parent | 2,4-disubstituted thiazoles |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | amidinesazacyclic compoundscarbonyl compoundsdialkylthioethersheteroaromatic compoundshydrocarbon derivativesorganic carbonic acids and derivativesorganic oxidesorganic sulfuric acids and derivativesorganopnictogen compoundssulfenyl compounds |
|---|
| Substituents | carbonyl groupcarbonic acid derivativeorganic sulfuric acid or derivativessulfenyl compoundaromatic heteromonocyclic compoundazacycledialkylthioetherheteroaromatic compoundamidineorganosulfur compoundorganic oxideorganic oxygen compoundthioether2,4-disubstituted 1,3-thiazoleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
