| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:31:46 UTC |
|---|
| Update Date | 2025-03-21 18:42:11 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00138122 |
|---|
| Frequency | 38.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H13N4O8P |
|---|
| Molecular Mass | 360.0471 |
|---|
| SMILES | O=c1[nH]cnc2c1ncn2C1OC(CO)C2OP(=O)(O)OC2C1O |
|---|
| InChI Key | XQJAYIMLRVXHHS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | hypoxanthines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsdioxaphospholanesheteroaromatic compoundshydrocarbon derivativesimidazoleslactamsmonosaccharidesn-substituted imidazolesorganic oxidesorganic phosphoric acids and derivativesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholspurines and purine derivativespyrimidonessecondary alcoholsvinylogous amides |
|---|
| Substituents | lactammonosaccharidepyrimidonepyrimidinesaccharideorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundoxaneprimary alcoholazolen-substituted imidazolealcoholvinylogous amideazacycleheteroaromatic compound1,3_dioxaphospholaneoxacycleorganic oxygen compoundsecondary alcoholhypoxanthinehydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativeorganooxygen compound |
|---|
