| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-21 00:32:29 UTC |
|---|
| Update Date | 2025-03-21 18:42:30 UTC |
|---|
| HMDB ID | HMDB0247221 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00139759 |
|---|
| Name | 7-(2-Hydroxyethyl)guanine |
|---|
| Frequency | 29.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H9N5O2 |
|---|
| Molecular Mass | 195.0756 |
|---|
| SMILES | Nc1nc(=O)c2c(ncn2CCO)[nH]1 |
|---|
| InChI Key | OCAWYYAMQRJCOY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | hypoxanthines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alcohols and polyolsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesn-substituted imidazolesorganic oxidesorganopnictogen compoundsprimary aminespurines and purine derivativespyrimidonesvinylogous amides |
|---|
| Substituents | alcoholvinylogous amideazacycleheteroaromatic compoundpyrimidonepyrimidineorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundhypoxanthinehydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compoundazolen-substituted imidazole |
|---|