Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 00:33:01 UTC |
---|
Update Date | 2025-03-21 18:45:22 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00141028 |
---|
Frequency | 17.6 |
---|
Structure | |
---|
Chemical Formula | C26H45NO35S5 |
---|
Molecular Mass | 1091.0376 |
---|
SMILES | CC(=O)NC1C(O)CC(COS(=O)(=O)O)OC1OC1C(O)C(COS(=O)(=O)O)OC(OC2C(COS(=O)(=O)O)OC(OC3C(O)C(O)OC(COS(=O)(=O)O)C3O)OC2COS(=O)(=O)O)C1O |
---|
InChI Key | UMPNRYNVOKVXKO-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | orthocarboxylic acid derivatives |
---|
Subclass | carboxylic acid orthoesters |
---|
Direct Parent | carboxylic acid orthoesters |
---|
Geometric Descriptor | aliphatic heteromonocyclic compounds |
---|
Alternative Parents | 1,3-dioxanesacetalsacetamidesalkyl sulfatescarbonyl compoundscarboxylic acids and derivativeshemiacetalshydrocarbon derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsortho estersoxacyclic compoundsoxanessecondary alcoholssecondary carboxylic acid amidessulfuric acid monoesters |
---|
Substituents | sulfuric acid monoestercarbonyl grouportho estermonosaccharidecarboxylic acid orthoestercarboxylic acid derivativesaccharideorganic oxideacetalalkyl sulfatealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetaloxaneorganoheterocyclic compoundacetamidealcoholorganic sulfuric acid or derivativescarboxamide groupoxacyclesecondary carboxylic acid amideorganic oxygen compoundsecondary alcoholsulfate-esterhydrocarbon derivativeorganic nitrogen compoundsulfuric acid estermeta-dioxaneorganooxygen compound |
---|