| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:35:19 UTC |
|---|
| Update Date | 2025-03-21 18:46:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00146346 |
|---|
| Frequency | 27.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H15N3O5 |
|---|
| Molecular Mass | 233.1012 |
|---|
| SMILES | N=C(N)NC1C(O)CC(O)(C(=O)O)CC1O |
|---|
| InChI Key | VYXMZLLGNVNUSU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | quinic acids and derivatives |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativescarbonyl compoundscarboximidamidescarboxylic acidscyclohexanolsdelta amino acids and derivativesguanidineshydrocarbon derivativesiminesmonocarboxylic acids and derivativesorganic oxidesorganopnictogen compoundstertiary alcohols |
|---|
| Substituents | carbonyl groupcarboxylic acidguanidineiminealpha-hydroxy acidcarboxylic acid derivativeorganic oxideorganonitrogen compoundorganopnictogen compounddelta amino acid or derivativescyclohexanolcarboximidamidehydroxy acidtertiary alcoholmonocarboxylic acid or derivativessecondary alcoholaliphatic homomonocyclic compoundhydrocarbon derivativeorganic nitrogen compoundquinic acid |
|---|
