| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:41:29 UTC |
|---|
| Update Date | 2025-03-21 18:48:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00160791 |
|---|
| Frequency | 28.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H21NO6 |
|---|
| Molecular Mass | 311.1369 |
|---|
| SMILES | OCC1OC(O)C(N=C(O)CCc2ccccc2)C(O)C1O |
|---|
| InChI Key | PQHVTMQPZIFHCD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | n-acyl-alpha-hexosamines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | benzene and substituted derivativescarboximidic acidshemiacetalshydrocarbon derivativesmonosaccharidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholspropargyl-type 1,3-dipolar organic compoundssecondary alcohols |
|---|
| Substituents | alcoholcarboximidic acidmonocyclic benzene moietyaromatic heteromonocyclic compoundmonosaccharideorganic 1,3-dipolar compoundn-acyl-alpha-hexosaminepropargyl-type 1,3-dipolar organic compoundoxacycleorganonitrogen compoundsecondary alcoholorganopnictogen compoundhemiacetalhydrocarbon derivativebenzenoidorganic nitrogen compoundoxaneprimary alcoholorganoheterocyclic compound |
|---|