| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:43:05 UTC |
|---|
| Update Date | 2025-03-21 18:49:10 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00164732 |
|---|
| Frequency | 45.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H4N4O3 |
|---|
| Molecular Mass | 180.0283 |
|---|
| SMILES | O=C(O)c1nc2ncnc(O)c2[nH]1 |
|---|
| InChI Key | VLTQYUMUUKLHOU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | purines and purine derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarboxylic acidsheteroaromatic compoundshydrocarbon derivativeshydroxypyrimidinesimidazolesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compounds |
|---|
| Substituents | carboxylic acidazacycleheteroaromatic compoundhydroxypyrimidinecarboxylic acid derivativepyrimidineorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundaromatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativepurineorganic nitrogen compoundorganooxygen compoundazole |
|---|
