| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-21 00:44:40 UTC |
|---|
| Update Date | 2025-03-21 18:49:43 UTC |
|---|
| HMDB ID | HMDB0033245 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00168565 |
|---|
| Name | 6-(Hydroxymethyl)-2,4(1H,3H)-pteridinedione |
|---|
| Frequency | 28.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H6N4O3 |
|---|
| Molecular Mass | 194.044 |
|---|
| SMILES | O=c1nc2[nH]cc(CO)nc-2c(=O)[nH]1 |
|---|
| InChI Key | SQXCACKAQINDFU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pteridines and derivatives |
|---|
| Direct Parent | pteridines and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | aromatic alcoholsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativeslactamsorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspyrazinespyrimidones |
|---|
| Substituents | aromatic alcoholalcoholcarbonic acid derivativelactamazacycleheteroaromatic compoundpyrimidonepteridinepyrimidineorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundpyrazineorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
