| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:47:16 UTC |
|---|
| Update Date | 2025-03-21 18:50:37 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00174709 |
|---|
| Frequency | 37.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H9N5O2 |
|---|
| Molecular Mass | 255.0756 |
|---|
| SMILES | Nc1nc(=O)c2nc(-c3ccccc3)c(=O)[nH]c2[nH]1 |
|---|
| InChI Key | XADHITZGXKKUFJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativeslactamsorganic oxidesorganooxygen compoundsorganopnictogen compoundsprimary aminespyrazinespyrimidonesvinylogous amides |
|---|
| Substituents | vinylogous amidemonocyclic benzene moietypterinlactamazacycleheteroaromatic compoundpyrimidonepyrimidineorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundpyrazineorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|