| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:50:34 UTC |
|---|
| Update Date | 2025-03-21 18:51:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00182625 |
|---|
| Frequency | 30.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H11N4O7P |
|---|
| Molecular Mass | 330.0365 |
|---|
| SMILES | O=P1(O)OC2C(CO)OC(n3cnc4ncnc(O)c43)C2O1 |
|---|
| InChI Key | IEAXDMHHRBMPJC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | purines and purine derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsdioxaphospholanesheteroaromatic compoundshydrocarbon derivativeshydroxypyrimidinesimidazolesn-substituted imidazolesorganic oxidesorganic phosphoric acids and derivativesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholstetrahydrofurans |
|---|
| Substituents | hydroxypyrimidinepyrimidineorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundprimary alcoholazolen-substituted imidazolealcoholazacycletetrahydrofuranheteroaromatic compound1,3_dioxaphospholaneoxacycleorganic oxygen compoundhydrocarbon derivativepurineorganic nitrogen compoundorganic phosphoric acid derivativeorganooxygen compound |
|---|
