| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:59:26 UTC |
|---|
| Update Date | 2025-03-21 18:55:07 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00202936 |
|---|
| Frequency | 29.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H12N4O7 |
|---|
| Molecular Mass | 312.0706 |
|---|
| SMILES | O=c1nc(O)c2ncnc(O)c2n1C1OC(CO)C(O)C1O |
|---|
| InChI Key | GKDKETRJMZSXTJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativeshydroxypyrimidinesmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholssecondary alcoholstetrahydrofurans |
|---|
| Substituents | alcoholcarbonic acid derivativeazacycletetrahydrofuranheteroaromatic compoundmonosaccharidepyrimidonehydroxypyrimidineoxacyclesaccharideorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundprimary alcoholorganooxygen compound |
|---|