| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 01:01:28 UTC |
|---|
| Update Date | 2025-03-21 18:55:50 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00207518 |
|---|
| Frequency | 10.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C55H108N2O6P+ |
|---|
| Molecular Mass | 923.794 |
|---|
| SMILES | CCCCCCC=CCCCCCCCC(=O)NC(COP(=O)(O)OCC[N+](C)(C)CCCCCCCC=CCCCCCCC)C(O)CCCCCCCC=CCCCCCCC |
|---|
| InChI Key | FZERTQFDRZVBTJ-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | phosphoethanolamines |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | aminescarbonyl compoundscarboxylic acids and derivativesdialkyl phosphateshydrocarbon derivativesn-acyl aminesorganic cationsorganic oxidesorganic saltsorganopnictogen compoundssecondary alcoholssecondary carboxylic acid amidestetraalkylammonium salts |
|---|
| Substituents | fatty acylaliphatic acyclic compoundcarbonyl groupfatty amidecarboxylic acid derivativephosphoethanolamineorganic oxideorganonitrogen compoundorganopnictogen compoundorganic cationorganic saltalcoholtetraalkylammonium saltquaternary ammonium saltcarboxamide groupn-acyl-aminesecondary carboxylic acid amidedialkyl phosphateorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundaminealkyl phosphateorganooxygen compound |
|---|
