| Record Information | 
|---|
| HMDB Status | Not Available | 
|---|
| Creation Date | 2024-02-21 01:52:17 UTC | 
|---|
| Update Date | 2025-03-21 20:06:04 UTC | 
|---|
| HMDB ID | Not Available | 
|---|
| Metabolite Identification | 
|---|
| DeepMet ID | DMID00324924 | 
|---|
| Frequency | 6.0 | 
|---|
| Structure |  | 
|---|
| Chemical Formula | C47H75N3O37 | 
|---|
| Molecular Mass | 1273.4079 | 
|---|
| SMILES | CC(=O)NC1C(O)CC(OCC2OC(OC3C(O)C(CO)OC(OC(C(O)CO)C(O)C(O)C=O)C3O)C(NC(C)=O)C(OC3OC(CO)C(O)C(OC4(C(=O)O)CC(O)C(NC(C)=O)C(C(O)C(O)CO)O4)C3O)C2O)(C(=O)O)OC1C(O)C(=O)O | 
|---|
| InChI Key | TYPBXGXQODDBST-UHFFFAOYSA-N | 
|---|
| Chemical Taxonomy | 
|---|
| Kingdom | organic compounds | 
|---|
| Superclass | organic oxygen compounds | 
|---|
| Class | organooxygen compounds | 
|---|
| Subclass | carbohydrates and carbohydrate conjugates | 
|---|
| Direct Parent | n-acyl-alpha-hexosamines | 
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds | 
|---|
| Alternative Parents | acetamidesalkyl glycosidesalpha hydroxy acids and derivativesalpha-hydroxyaldehydesbeta-hydroxy aldehydesc-glucuronidescarboxylic acidsfatty acyl glycosides of mono- and disaccharidesgamma amino acids and derivativeshydrocarbon derivativesketalsmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholspyran carboxylic acidssecondary alcoholssecondary carboxylic acid amidestricarboxylic acids and derivatives | 
|---|
| Substituents | fatty acylfatty acyl glycoside of mono- or disaccharidebeta-hydroxy aldehydecarbonyl groupcarboxylic acidgamma amino acid or derivativesalpha-hydroxy acidmonosaccharidetricarboxylic acid or derivativescarboxylic acid derivativepyran carboxylic acidn-acyl-alpha-hexosamineorganic oxidealpha-hydroxyaldehydeacetalketalaliphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundoxaneprimary alcoholorganoheterocyclic compoundacetamidec-glucuronidealcoholpyran carboxylic acid or derivativesfatty acyl glycosidealdehydehydroxy acidcarboxamide groupoxacyclesecondary carboxylic acid amidepyransecondary alcoholhydrocarbon derivativeorganic nitrogen compoundalkyl glycoside | 
|---|